C13H18N4O2S — CID 89063223
4-butoxy-6-(1-sulfanylethylamino)-1H-pyrido[3,2-d]pyrimidin-2-one (PubChem CID 89063223) has the molecular formula C13H18N4O2S and a molecular weight of 294.38 g/mol. Its IUPAC name is 4-butoxy-6-(1-sulfanylethylamino)-1H-pyrido[3,2-d]pyrimidin-2-one.
| Compound Name | 4-butoxy-6-(1-sulfanylethylamino)-1H-pyrido[3,2-d]pyrimidin-2-one |
|---|---|
| PubChem CID | 89063223 |
| Molecular Formula | C13H18N4O2S |
| Molecular Weight | 294.38 g/mol |
| Exact Mass | 294.12 |
| IUPAC Name | 4-butoxy-6-(1-sulfanylethylamino)-1H-pyrido[3,2-d]pyrimidin-2-one |
| SMILES | CCCCOc1nc(=O)[nH]c2ccc(NC(C)S)nc12 |
| InChI | InChI=1S/C13H18N4O2S/c1-3-4-7-19-12-11-9(15-13(18)17-12)5-6-10(16-11)14-8(2)20/h5-6,8,20H,3-4,7H2,1-2H3,(H,14,16)(H,15,17,18) |
| InChIKey | GWROFSPTMPLOKU-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 79.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.38 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|