C20H23FN4O3 — CID 89067468
(5S)-3-[3-fluoro-4-[2-(pyridin-3-ylmethyl)-1,2,5-oxadiazepan-5-yl]phenyl]-5-methyl-1,3-oxazolidin-2-one (PubChem CID 89067468) has the molecular formula C20H23FN4O3 and a molecular weight of 386.43 g/mol. Its IUPAC name is (5S)-3-[3-fluoro-4-[2-(pyridin-3-ylmethyl)-1,2,5-oxadiazepan-5-yl]phenyl]-5-methyl-1,3-oxazolidin-2-one.
| Compound Name | (5S)-3-[3-fluoro-4-[2-(pyridin-3-ylmethyl)-1,2,5-oxadiazepan-5-yl]phenyl]-5-methyl-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 89067468 |
| Molecular Formula | C20H23FN4O3 |
| Molecular Weight | 386.43 g/mol |
| Exact Mass | 386.18 |
| IUPAC Name | (5S)-3-[3-fluoro-4-[2-(pyridin-3-ylmethyl)-1,2,5-oxadiazepan-5-yl]phenyl]-5-methyl-1,3-oxazolidin-2-one |
| SMILES | C[C@H]1CN(c2ccc(N3CCON(Cc4cccnc4)CC3)c(F)c2)C(=O)O1 |
| InChI | InChI=1S/C20H23FN4O3/c1-15-13-25(20(26)28-15)17-4-5-19(18(21)11-17)23-7-8-24(27-10-9-23)14-16-3-2-6-22-12-16/h2-6,11-12,15H,7-10,13-14H2,1H3/t15-/m0/s1 |
| InChIKey | CHIAKJXDCBCDKQ-HNNXBMFYSA-N |
| XLogP | 2.82 |
| TPSA | 58.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.43 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|