C22H15F5INO6S2 — CID 89073137
(2,3,4,5,6-pentafluorophenyl) 5-iodo-2-[4-[(1S)-1-(methanesulfonamido)ethyl]phenyl]sulfonylbenzoate (PubChem CID 89073137) has the molecular formula C22H15F5INO6S2 and a molecular weight of 675.39 g/mol. Its IUPAC name is (2,3,4,5,6-pentafluorophenyl) 5-iodo-2-[4-[(1S)-1-(methanesulfonamido)ethyl]phenyl]sulfonylbenzoate.
| Compound Name | (2,3,4,5,6-pentafluorophenyl) 5-iodo-2-[4-[(1S)-1-(methanesulfonamido)ethyl]phenyl]sulfonylbenzoate |
|---|---|
| PubChem CID | 89073137 |
| Molecular Formula | C22H15F5INO6S2 |
| Molecular Weight | 675.39 g/mol |
| Exact Mass | 674.93 |
| IUPAC Name | (2,3,4,5,6-pentafluorophenyl) 5-iodo-2-[4-[(1S)-1-(methanesulfonamido)ethyl]phenyl]sulfonylbenzoate |
| SMILES | C[C@H](NS(C)(=O)=O)c1ccc(S(=O)(=O)c2ccc(I)cc2C(=O)Oc2c(F)c(F)c(F)c(F)c2F)cc1 |
| InChI | InChI=1S/C22H15F5INO6S2/c1-10(29-36(2,31)32)11-3-6-13(7-4-11)37(33,34)15-8-5-12(28)9-14(15)22(30)35-21-19(26)17(24)16(23)18(25)20(21)27/h3-10,29H,1-2H3/t10-/m0/s1 |
| InChIKey | GGIJOINZKYSEML-JTQLQIEISA-N |
| XLogP | 4.65 |
| TPSA | 106.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 675.39 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|