C29H35N3O4 — CID 89073492
1-[4-formyl-1-(naphthalen-1-ylmethyl)piperidin-4-yl]-1-(3-hydroxypropyl)-3-[(3-methoxyphenyl)methyl]urea (PubChem CID 89073492) has the molecular formula C29H35N3O4 and a molecular weight of 489.62 g/mol. Its IUPAC name is 1-[4-formyl-1-(naphthalen-1-ylmethyl)piperidin-4-yl]-1-(3-hydroxypropyl)-3-[(3-methoxyphenyl)methyl]urea.
| Compound Name | 1-[4-formyl-1-(naphthalen-1-ylmethyl)piperidin-4-yl]-1-(3-hydroxypropyl)-3-[(3-methoxyphenyl)methyl]urea |
|---|---|
| PubChem CID | 89073492 |
| Molecular Formula | C29H35N3O4 |
| Molecular Weight | 489.62 g/mol |
| Exact Mass | 489.26 |
| IUPAC Name | 1-[4-formyl-1-(naphthalen-1-ylmethyl)piperidin-4-yl]-1-(3-hydroxypropyl)-3-[(3-methoxyphenyl)methyl]urea |
| SMILES | COc1cccc(CNC(=O)N(CCCO)C2(C=O)CCN(Cc3cccc4ccccc34)CC2)c1 |
| InChI | InChI=1S/C29H35N3O4/c1-36-26-11-4-7-23(19-26)20-30-28(35)32(15-6-18-33)29(22-34)13-16-31(17-14-29)21-25-10-5-9-24-8-2-3-12-27(24)25/h2-5,7-12,19,22,33H,6,13-18,20-21H2,1H3,(H,30,35) |
| InChIKey | JRWRGZFXQAWBFX-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 82.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.62 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|