C29H41N3O7 — CID 89103134
3-[(3,5-dimethoxyphenyl)methyl]-1-[1-[(3,5-dimethoxyphenyl)methyl]-4-formylpiperidin-4-yl]-1-(3-methoxypropyl)urea (PubChem CID 89103134) has the molecular formula C29H41N3O7 and a molecular weight of 543.66 g/mol. Its IUPAC name is 3-[(3,5-dimethoxyphenyl)methyl]-1-[1-[(3,5-dimethoxyphenyl)methyl]-4-formylpiperidin-4-yl]-1-(3-methoxypropyl)urea.
| Compound Name | 3-[(3,5-dimethoxyphenyl)methyl]-1-[1-[(3,5-dimethoxyphenyl)methyl]-4-formylpiperidin-4-yl]-1-(3-methoxypropyl)urea |
|---|---|
| PubChem CID | 89103134 |
| Molecular Formula | C29H41N3O7 |
| Molecular Weight | 543.66 g/mol |
| Exact Mass | 543.29 |
| IUPAC Name | 3-[(3,5-dimethoxyphenyl)methyl]-1-[1-[(3,5-dimethoxyphenyl)methyl]-4-formylpiperidin-4-yl]-1-(3-methoxypropyl)urea |
| SMILES | COCCCN(C(=O)NCc1cc(OC)cc(OC)c1)C1(C=O)CCN(Cc2cc(OC)cc(OC)c2)CC1 |
| InChI | InChI=1S/C29H41N3O7/c1-35-12-6-9-32(28(34)30-19-22-13-24(36-2)17-25(14-22)37-3)29(21-33)7-10-31(11-8-29)20-23-15-26(38-4)18-27(16-23)39-5/h13-18,21H,6-12,19-20H2,1-5H3,(H,30,34) |
| InChIKey | MCHPJOJBOVANLQ-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 98.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.66 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|