C32H34N4O3 — CID 89103140
1-[4-formyl-1-(naphthalen-1-ylmethyl)piperidin-4-yl]-3-[(3-methoxyphenyl)methyl]-1-(pyridin-4-ylmethyl)urea (PubChem CID 89103140) has the molecular formula C32H34N4O3 and a molecular weight of 522.65 g/mol. Its IUPAC name is 1-[4-formyl-1-(naphthalen-1-ylmethyl)piperidin-4-yl]-3-[(3-methoxyphenyl)methyl]-1-(pyridin-4-ylmethyl)urea.
| Compound Name | 1-[4-formyl-1-(naphthalen-1-ylmethyl)piperidin-4-yl]-3-[(3-methoxyphenyl)methyl]-1-(pyridin-4-ylmethyl)urea |
|---|---|
| PubChem CID | 89103140 |
| Molecular Formula | C32H34N4O3 |
| Molecular Weight | 522.65 g/mol |
| Exact Mass | 522.26 |
| IUPAC Name | 1-[4-formyl-1-(naphthalen-1-ylmethyl)piperidin-4-yl]-3-[(3-methoxyphenyl)methyl]-1-(pyridin-4-ylmethyl)urea |
| SMILES | COc1cccc(CNC(=O)N(Cc2ccncc2)C2(C=O)CCN(Cc3cccc4ccccc34)CC2)c1 |
| InChI | InChI=1S/C32H34N4O3/c1-39-29-10-4-6-26(20-29)21-34-31(38)36(22-25-12-16-33-17-13-25)32(24-37)14-18-35(19-15-32)23-28-9-5-8-27-7-2-3-11-30(27)28/h2-13,16-17,20,24H,14-15,18-19,21-23H2,1H3,(H,34,38) |
| InChIKey | BUOKUVKVQPVDFP-UHFFFAOYSA-N |
| XLogP | 5.19 |
| TPSA | 74.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.65 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|