C26H35N3O6 — CID 89103114
3-[(3,5-dimethoxyphenyl)methyl]-1-[1-[(3,5-dimethoxyphenyl)methyl]-4-formylpiperidin-4-yl]-1-methylurea (PubChem CID 89103114) has the molecular formula C26H35N3O6 and a molecular weight of 485.58 g/mol. Its IUPAC name is 3-[(3,5-dimethoxyphenyl)methyl]-1-[1-[(3,5-dimethoxyphenyl)methyl]-4-formylpiperidin-4-yl]-1-methylurea.
| Compound Name | 3-[(3,5-dimethoxyphenyl)methyl]-1-[1-[(3,5-dimethoxyphenyl)methyl]-4-formylpiperidin-4-yl]-1-methylurea |
|---|---|
| PubChem CID | 89103114 |
| Molecular Formula | C26H35N3O6 |
| Molecular Weight | 485.58 g/mol |
| Exact Mass | 485.25 |
| IUPAC Name | 3-[(3,5-dimethoxyphenyl)methyl]-1-[1-[(3,5-dimethoxyphenyl)methyl]-4-formylpiperidin-4-yl]-1-methylurea |
| SMILES | COc1cc(CNC(=O)N(C)C2(C=O)CCN(Cc3cc(OC)cc(OC)c3)CC2)cc(OC)c1 |
| InChI | InChI=1S/C26H35N3O6/c1-28(25(31)27-16-19-10-21(32-2)14-22(11-19)33-3)26(18-30)6-8-29(9-7-26)17-20-12-23(34-4)15-24(13-20)35-5/h10-15,18H,6-9,16-17H2,1-5H3,(H,27,31) |
| InChIKey | GGRGKKVWPKNJCP-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 89.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.58 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|