C31H37N3O5 — CID 89103139
1-benzyl-1-[1-[(3,5-dimethoxyphenyl)methyl]-4-formylpiperidin-4-yl]-3-[(3-methoxyphenyl)methyl]urea (PubChem CID 89103139) has the molecular formula C31H37N3O5 and a molecular weight of 531.65 g/mol. Its IUPAC name is 1-benzyl-1-[1-[(3,5-dimethoxyphenyl)methyl]-4-formylpiperidin-4-yl]-3-[(3-methoxyphenyl)methyl]urea.
| Compound Name | 1-benzyl-1-[1-[(3,5-dimethoxyphenyl)methyl]-4-formylpiperidin-4-yl]-3-[(3-methoxyphenyl)methyl]urea |
|---|---|
| PubChem CID | 89103139 |
| Molecular Formula | C31H37N3O5 |
| Molecular Weight | 531.65 g/mol |
| Exact Mass | 531.27 |
| IUPAC Name | 1-benzyl-1-[1-[(3,5-dimethoxyphenyl)methyl]-4-formylpiperidin-4-yl]-3-[(3-methoxyphenyl)methyl]urea |
| SMILES | COc1cccc(CNC(=O)N(Cc2ccccc2)C2(C=O)CCN(Cc3cc(OC)cc(OC)c3)CC2)c1 |
| InChI | InChI=1S/C31H37N3O5/c1-37-27-11-7-10-25(16-27)20-32-30(36)34(22-24-8-5-4-6-9-24)31(23-35)12-14-33(15-13-31)21-26-17-28(38-2)19-29(18-26)39-3/h4-11,16-19,23H,12-15,20-22H2,1-3H3,(H,32,36) |
| InChIKey | CYGVLCKRDQBOKW-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 80.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.65 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|