C6H8NO2S- — CID 89073879
4-aminocyclohexa-1,5-diene-1-sulfinate (PubChem CID 89073879) has the molecular formula C6H8NO2S- and a molecular weight of 158.20 g/mol. Its IUPAC name is 4-aminocyclohexa-1,5-diene-1-sulfinate.
| Compound Name | 4-aminocyclohexa-1,5-diene-1-sulfinate |
|---|---|
| PubChem CID | 89073879 |
| Molecular Formula | C6H8NO2S- |
| Molecular Weight | 158.20 g/mol |
| Exact Mass | 158.03 |
| IUPAC Name | 4-aminocyclohexa-1,5-diene-1-sulfinate |
| SMILES | NC1C=CC(S(=O)[O-])=CC1 |
| InChI | InChI=1S/C6H9NO2S/c7-5-1-3-6(4-2-5)10(8)9/h1,3-5H,2,7H2,(H,8,9)/p-1 |
| InChIKey | GKYBMXOYKFMMKY-UHFFFAOYSA-M |
| XLogP | 0.04 |
| TPSA | 66.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 158.20 |
| LogP ≤ 5 | 0.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|