C10H20S — CID 89079545
(4S)-4,5,6-trimethylhept-5-ene-1-thiol (PubChem CID 89079545) has the molecular formula C10H20S and a molecular weight of 172.34 g/mol. Its IUPAC name is (4S)-4,5,6-trimethylhept-5-ene-1-thiol.
| Compound Name | (4S)-4,5,6-trimethylhept-5-ene-1-thiol |
|---|---|
| PubChem CID | 89079545 |
| Molecular Formula | C10H20S |
| Molecular Weight | 172.34 g/mol |
| Exact Mass | 172.13 |
| IUPAC Name | (4S)-4,5,6-trimethylhept-5-ene-1-thiol |
| SMILES | CC(C)=C(C)[C@@H](C)CCCS |
| InChI | InChI=1S/C10H20S/c1-8(2)10(4)9(3)6-5-7-11/h9,11H,5-7H2,1-4H3/t9-/m0/s1 |
| InChIKey | HMFGTNXZUVJIMO-VIFPVBQESA-N |
| XLogP | 3.69 |
| TPSA | 0.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 172.34 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|