C17H22N4O2 — CID 89080422
(4-aminophenyl)-[4-[methyl(1,3-oxazol-2-ylmethyl)amino]piperidin-1-yl]methanone (PubChem CID 89080422) has the molecular formula C17H22N4O2 and a molecular weight of 314.39 g/mol. Its IUPAC name is (4-aminophenyl)-[4-[methyl(1,3-oxazol-2-ylmethyl)amino]piperidin-1-yl]methanone.
| Compound Name | (4-aminophenyl)-[4-[methyl(1,3-oxazol-2-ylmethyl)amino]piperidin-1-yl]methanone |
|---|---|
| PubChem CID | 89080422 |
| Molecular Formula | C17H22N4O2 |
| Molecular Weight | 314.39 g/mol |
| Exact Mass | 314.17 |
| IUPAC Name | (4-aminophenyl)-[4-[methyl(1,3-oxazol-2-ylmethyl)amino]piperidin-1-yl]methanone |
| SMILES | CN(Cc1ncco1)C1CCN(C(=O)c2ccc(N)cc2)CC1 |
| InChI | InChI=1S/C17H22N4O2/c1-20(12-16-19-8-11-23-16)15-6-9-21(10-7-15)17(22)13-2-4-14(18)5-3-13/h2-5,8,11,15H,6-7,9-10,12,18H2,1H3 |
| InChIKey | UPDMIPQDMSBKQC-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 75.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.39 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|