About 1-amino-3-carbamoyl-1,3-dimethylurea
1-amino-3-carbamoyl-1,3-dimethylurea (PubChem CID 89086493) has the molecular formula C4H10N4O2
and a molecular weight of 146.15 g/mol. Its IUPAC name is 1-amino-3-carbamoyl-1,3-dimethylurea.
Molecular Properties
| Compound Name | 1-amino-3-carbamoyl-1,3-dimethylurea |
| PubChem CID | 89086493 |
| Molecular Formula | C4H10N4O2 |
| Molecular Weight | 146.15 g/mol |
| Exact Mass | 146.08 |
| IUPAC Name | 1-amino-3-carbamoyl-1,3-dimethylurea |
| SMILES | CN(N)C(=O)N(C)C(N)=O |
| InChI | InChI=1S/C4H10N4O2/c1-7(3(5)9)4(10)8(2)6/h6H2,1-2H3,(H2,5,9) |
| InChIKey | UDDZPJJOQVYYSU-UHFFFAOYSA-N |
| XLogP | -1.08 |
| TPSA | 92.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 146.15 |
| LogP ≤ 5 | -1.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 1-amino-3-carbamoyl-1,3-dimethylurea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-amino-3-carbamoyl-1,3-dimethylurea?
The IUPAC name of 1-amino-3-carbamoyl-1,3-dimethylurea (CID 89086493) is 1-amino-3-carbamoyl-1,3-dimethylurea.
What is the SMILES notation for 1-amino-3-carbamoyl-1,3-dimethylurea?
The canonical SMILES for 1-amino-3-carbamoyl-1,3-dimethylurea is CN(N)C(=O)N(C)C(N)=O.
What is the InChIKey of 1-amino-3-carbamoyl-1,3-dimethylurea?
The InChIKey is UDDZPJJOQVYYSU-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H10N4O2/c1-7(3(5)9)4(10)8(2)6/h6H2,1-2H3,(H2,5,9).
What are the key properties of 1-amino-3-carbamoyl-1,3-dimethylurea?
1-amino-3-carbamoyl-1,3-dimethylurea has a molecular weight of 146.15 g/mol, XLogP of -1.08, 0 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-amino-3-carbamoyl-1,3-dimethylurea is sourced from PubChem (CID 89086493), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).