C28H33N7O — CID 89105633
1-[2-[ethyl-[2-methyl-3-(methylamino)propyl]amino]ethyl]-3-[4-(3-ethynylanilino)quinazolin-6-yl]imidazol-2-one (PubChem CID 89105633) has the molecular formula C28H33N7O and a molecular weight of 483.62 g/mol. Its IUPAC name is 1-[2-[ethyl-[2-methyl-3-(methylamino)propyl]amino]ethyl]-3-[4-(3-ethynylanilino)quinazolin-6-yl]imidazol-2-one.
| Compound Name | 1-[2-[ethyl-[2-methyl-3-(methylamino)propyl]amino]ethyl]-3-[4-(3-ethynylanilino)quinazolin-6-yl]imidazol-2-one |
|---|---|
| PubChem CID | 89105633 |
| Molecular Formula | C28H33N7O |
| Molecular Weight | 483.62 g/mol |
| Exact Mass | 483.27 |
| IUPAC Name | 1-[2-[ethyl-[2-methyl-3-(methylamino)propyl]amino]ethyl]-3-[4-(3-ethynylanilino)quinazolin-6-yl]imidazol-2-one |
| SMILES | C#Cc1cccc(Nc2ncnc3ccc(-n4ccn(CCN(CC)CC(C)CNC)c4=O)cc23)c1 |
| InChI | InChI=1S/C28H33N7O/c1-5-22-8-7-9-23(16-22)32-27-25-17-24(10-11-26(25)30-20-31-27)35-15-14-34(28(35)36)13-12-33(6-2)19-21(3)18-29-4/h1,7-11,14-17,20-21,29H,6,12-13,18-19H2,2-4H3,(H,30,31,32) |
| InChIKey | SXKDXSYTBGXJBI-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 80.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.62 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|