C23H22N6O3S — CID 44600445
N-[2-[3-[4-(3-ethynylanilino)quinazolin-6-yl]-2-oxoimidazol-1-yl]ethyl]-N-methylmethanesulfonamide (PubChem CID 44600445) has the molecular formula C23H22N6O3S and a molecular weight of 462.54 g/mol. Its IUPAC name is N-[2-[3-[4-(3-ethynylanilino)quinazolin-6-yl]-2-oxoimidazol-1-yl]ethyl]-N-methylmethanesulfonamide.
| Compound Name | N-[2-[3-[4-(3-ethynylanilino)quinazolin-6-yl]-2-oxoimidazol-1-yl]ethyl]-N-methylmethanesulfonamide |
|---|---|
| PubChem CID | 44600445 |
| Molecular Formula | C23H22N6O3S |
| Molecular Weight | 462.54 g/mol |
| Exact Mass | 462.15 |
| IUPAC Name | N-[2-[3-[4-(3-ethynylanilino)quinazolin-6-yl]-2-oxoimidazol-1-yl]ethyl]-N-methylmethanesulfonamide |
| SMILES | C#Cc1cccc(Nc2ncnc3ccc(-n4ccn(CCN(C)S(C)(=O)=O)c4=O)cc23)c1 |
| InChI | InChI=1S/C23H22N6O3S/c1-4-17-6-5-7-18(14-17)26-22-20-15-19(8-9-21(20)24-16-25-22)29-13-12-28(23(29)30)11-10-27(2)33(3,31)32/h1,5-9,12-16H,10-11H2,2-3H3,(H,24,25,26) |
| InChIKey | BSYHXPAZAQCSDT-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 102.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.54 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|