C16H25NO2 — CID 89119098
N-[(2Z,4Z)-hepta-2,4,6-trienyl]-2-(methoxymethyl)-2,4-dimethylpent-3-enamide (PubChem CID 89119098) has the molecular formula C16H25NO2 and a molecular weight of 263.38 g/mol. Its IUPAC name is N-[(2Z,4Z)-hepta-2,4,6-trienyl]-2-(methoxymethyl)-2,4-dimethylpent-3-enamide.
| Compound Name | N-[(2Z,4Z)-hepta-2,4,6-trienyl]-2-(methoxymethyl)-2,4-dimethylpent-3-enamide |
|---|---|
| PubChem CID | 89119098 |
| Molecular Formula | C16H25NO2 |
| Molecular Weight | 263.38 g/mol |
| Exact Mass | 263.19 |
| IUPAC Name | N-[(2Z,4Z)-hepta-2,4,6-trienyl]-2-(methoxymethyl)-2,4-dimethylpent-3-enamide |
| SMILES | C=C/C=C\C=C/CNC(=O)C(C)(C=C(C)C)COC |
| InChI | InChI=1S/C16H25NO2/c1-6-7-8-9-10-11-17-15(18)16(4,13-19-5)12-14(2)3/h6-10,12H,1,11,13H2,2-5H3,(H,17,18)/b8-7-,10-9- |
| InChIKey | JMXCJHQOPYEBTH-QRLRYFCNSA-N |
| XLogP | 3.02 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.38 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|