C7H8O5 — CID 89119376
(3aS,6aR)-4-hydroxy-2-oxo-3a,4,6,6a-tetrahydro-3H-furo[2,3-c]furan-3-carbaldehyde (PubChem CID 89119376) has the molecular formula C7H8O5 and a molecular weight of 172.14 g/mol. Its IUPAC name is (3aS,6aR)-4-hydroxy-2-oxo-3a,4,6,6a-tetrahydro-3H-furo[2,3-c]furan-3-carbaldehyde.
| Compound Name | (3aS,6aR)-4-hydroxy-2-oxo-3a,4,6,6a-tetrahydro-3H-furo[2,3-c]furan-3-carbaldehyde |
|---|---|
| PubChem CID | 89119376 |
| Molecular Formula | C7H8O5 |
| Molecular Weight | 172.14 g/mol |
| Exact Mass | 172.04 |
| IUPAC Name | (3aS,6aR)-4-hydroxy-2-oxo-3a,4,6,6a-tetrahydro-3H-furo[2,3-c]furan-3-carbaldehyde |
| SMILES | O=CC1C(=O)O[C@H]2COC(O)[C@@H]12 |
| InChI | InChI=1S/C7H8O5/c8-1-3-5-4(12-6(3)9)2-11-7(5)10/h1,3-5,7,10H,2H2/t3?,4-,5-,7?/m0/s1 |
| InChIKey | HUCWILZDYPQVMC-BDSZFYSVSA-N |
| XLogP | -1.31 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 172.14 |
| LogP ≤ 5 | -1.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|