C22H46N3O2+ — CID 89127700
ethyl-dimethyl-[3-[2-(2,2,6,6-tetramethyl-4-propylpiperidin-1-yl)oxypropanoylamino]propyl]azanium (PubChem CID 89127700) has the molecular formula C22H46N3O2+ and a molecular weight of 384.63 g/mol. Its IUPAC name is ethyl-dimethyl-[3-[2-(2,2,6,6-tetramethyl-4-propylpiperidin-1-yl)oxypropanoylamino]propyl]azanium.
| Compound Name | ethyl-dimethyl-[3-[2-(2,2,6,6-tetramethyl-4-propylpiperidin-1-yl)oxypropanoylamino]propyl]azanium |
|---|---|
| PubChem CID | 89127700 |
| Molecular Formula | C22H46N3O2+ |
| Molecular Weight | 384.63 g/mol |
| Exact Mass | 384.36 |
| IUPAC Name | ethyl-dimethyl-[3-[2-(2,2,6,6-tetramethyl-4-propylpiperidin-1-yl)oxypropanoylamino]propyl]azanium |
| SMILES | CCCC1CC(C)(C)N(OC(C)C(=O)NCCC[N+](C)(C)CC)C(C)(C)C1 |
| InChI | InChI=1S/C22H45N3O2/c1-10-13-19-16-21(4,5)24(22(6,7)17-19)27-18(3)20(26)23-14-12-15-25(8,9)11-2/h18-19H,10-17H2,1-9H3/p+1 |
| InChIKey | FOKPVAQNLFJNCQ-UHFFFAOYSA-O |
| XLogP | 3.98 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.63 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|