C17H37NO4Si — CID 150270110
trimethoxy-[2-(2,2,6,6-tetramethyl-4-propylpiperidin-1-yl)oxyethyl]silane (PubChem CID 150270110) has the molecular formula C17H37NO4Si and a molecular weight of 347.57 g/mol. Its IUPAC name is trimethoxy-[2-(2,2,6,6-tetramethyl-4-propylpiperidin-1-yl)oxyethyl]silane.
| Compound Name | trimethoxy-[2-(2,2,6,6-tetramethyl-4-propylpiperidin-1-yl)oxyethyl]silane |
|---|---|
| PubChem CID | 150270110 |
| Molecular Formula | C17H37NO4Si |
| Molecular Weight | 347.57 g/mol |
| Exact Mass | 347.25 |
| IUPAC Name | trimethoxy-[2-(2,2,6,6-tetramethyl-4-propylpiperidin-1-yl)oxyethyl]silane |
| SMILES | CCCC1CC(C)(C)N(OCC[Si](OC)(OC)OC)C(C)(C)C1 |
| InChI | InChI=1S/C17H37NO4Si/c1-9-10-15-13-16(2,3)18(17(4,5)14-15)22-11-12-23(19-6,20-7)21-8/h15H,9-14H2,1-8H3 |
| InChIKey | GDJRAVSRNGTOTO-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 40.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.57 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|