C24H45N5O — CID 141005389
N-[4-(2,2,6,6-tetramethyl-1-octoxypiperidin-4-yl)butyl]-1,3,5-triazin-2-amine (PubChem CID 141005389) has the molecular formula C24H45N5O and a molecular weight of 419.66 g/mol. Its IUPAC name is N-[4-(2,2,6,6-tetramethyl-1-octoxypiperidin-4-yl)butyl]-1,3,5-triazin-2-amine.
| Compound Name | N-[4-(2,2,6,6-tetramethyl-1-octoxypiperidin-4-yl)butyl]-1,3,5-triazin-2-amine |
|---|---|
| PubChem CID | 141005389 |
| Molecular Formula | C24H45N5O |
| Molecular Weight | 419.66 g/mol |
| Exact Mass | 419.36 |
| IUPAC Name | N-[4-(2,2,6,6-tetramethyl-1-octoxypiperidin-4-yl)butyl]-1,3,5-triazin-2-amine |
| SMILES | CCCCCCCCON1C(C)(C)CC(CCCCNc2ncncn2)CC1(C)C |
| InChI | InChI=1S/C24H45N5O/c1-6-7-8-9-10-13-16-30-29-23(2,3)17-21(18-24(29,4)5)14-11-12-15-26-22-27-19-25-20-28-22/h19-21H,6-18H2,1-5H3,(H,25,26,27,28) |
| InChIKey | FSHFXNVZNMBWPO-UHFFFAOYSA-N |
| XLogP | 6.02 |
| TPSA | 63.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.66 |
| LogP ≤ 5 | 6.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|