C51H98N8O4 — CID 19090229
6-[[4,6-bis[1-(2,2,6,6-tetramethyl-1-octoxypiperidin-4-yl)butylamino]-1,3,5-triazin-2-yl]amino]hexanoic acid (PubChem CID 19090229) has the molecular formula C51H98N8O4 and a molecular weight of 887.40 g/mol. Its IUPAC name is 6-[[4,6-bis[1-(2,2,6,6-tetramethyl-1-octoxypiperidin-4-yl)butylamino]-1,3,5-triazin-2-yl]amino]hexanoic acid.
| Compound Name | 6-[[4,6-bis[1-(2,2,6,6-tetramethyl-1-octoxypiperidin-4-yl)butylamino]-1,3,5-triazin-2-yl]amino]hexanoic acid |
|---|---|
| PubChem CID | 19090229 |
| Molecular Formula | C51H98N8O4 |
| Molecular Weight | 887.40 g/mol |
| Exact Mass | 886.77 |
| IUPAC Name | 6-[[4,6-bis[1-(2,2,6,6-tetramethyl-1-octoxypiperidin-4-yl)butylamino]-1,3,5-triazin-2-yl]amino]hexanoic acid |
| SMILES | CCCCCCCCON1C(C)(C)CC(C(CCC)Nc2nc(NCCCCCC(=O)O)nc(NC(CCC)C3CC(C)(C)N(OCCCCCCCC)C(C)(C)C3)n2)CC1(C)C |
| InChI | InChI=1S/C51H98N8O4/c1-13-17-19-21-23-28-34-62-58-48(5,6)36-40(37-49(58,7)8)42(30-15-3)53-46-55-45(52-33-27-25-26-32-44(60)61)56-47(57-46)54-43(31-16-4)41-38-50(9,10)59(51(11,12)39-41)63-35-29-24-22-20-18-14-2/h40-43H,13-39H2,1-12H3,(H,60,61)(H3,52,53,54,55,56,57) |
| InChIKey | QVLBFMJNQQYKGS-UHFFFAOYSA-N |
| XLogP | 13.21 |
| TPSA | 137.00 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 33 |
| Heavy Atoms | 63 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 887.40 |
| LogP ≤ 5 | 13.21 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|