C54H105N9O5 — CID 57197309
2-N,4-N-bis(methoxymethyl)-2-N,4-N-bis(1-octoxypiperidin-4-yl)-6-N-[4-(2,2,6,6-tetramethyl-1-octoxypiperidin-4-yl)butyl]-1,3,5-triazine-2,4,6-triamine (PubChem CID 57197309) has the molecular formula C54H105N9O5 and a molecular weight of 960.49 g/mol. Its IUPAC name is 2-N,4-N-bis(methoxymethyl)-2-N,4-N-bis(1-octoxypiperidin-4-yl)-6-N-[4-(2,2,6,6-tetramethyl-1-octoxypiperidin-4-yl)butyl]-1,3,5-triazine-2,4,6-triamine.
| Compound Name | 2-N,4-N-bis(methoxymethyl)-2-N,4-N-bis(1-octoxypiperidin-4-yl)-6-N-[4-(2,2,6,6-tetramethyl-1-octoxypiperidin-4-yl)butyl]-1,3,5-triazine-2,4,6-triamine |
|---|---|
| PubChem CID | 57197309 |
| Molecular Formula | C54H105N9O5 |
| Molecular Weight | 960.49 g/mol |
| Exact Mass | 959.82 |
| IUPAC Name | 2-N,4-N-bis(methoxymethyl)-2-N,4-N-bis(1-octoxypiperidin-4-yl)-6-N-[4-(2,2,6,6-tetramethyl-1-octoxypiperidin-4-yl)butyl]-1,3,5-triazine-2,4,6-triamine |
| SMILES | CCCCCCCCON1CCC(N(COC)c2nc(NCCCCC3CC(C)(C)N(OCCCCCCCC)C(C)(C)C3)nc(N(COC)C3CCN(OCCCCCCCC)CC3)n2)CC1 |
| InChI | InChI=1S/C54H105N9O5/c1-10-13-16-19-22-27-40-66-59-36-31-48(32-37-59)61(45-64-8)51-56-50(57-52(58-51)62(46-65-9)49-33-38-60(39-34-49)67-41-28-23-20-17-14-11-2)55-35-26-25-30-47-43-53(4,5)63(54(6,7)44-47)68-42-29-24-21-18-15-12-3/h47-49H,10-46H2,1-9H3,(H,55,56,57,58) |
| InChIKey | QMPMQZURWKHQBT-UHFFFAOYSA-N |
| XLogP | 12.35 |
| TPSA | 113.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 38 |
| Heavy Atoms | 68 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 960.49 |
| LogP ≤ 5 | 12.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|