C35H72Cl3N7O — CID 172693045
2-N',2-N',4-N,4-N-tetrabutyl-4,6,6-trichloro-2-N-[4-(2,2,6,6-tetramethyl-1-propoxypiperidin-4-yl)butyl]-1,3,5-triazinane-2,2,4-triamine (PubChem CID 172693045) has the molecular formula C35H72Cl3N7O and a molecular weight of 713.37 g/mol. Its IUPAC name is 2-N',2-N',4-N,4-N-tetrabutyl-4,6,6-trichloro-2-N-[4-(2,2,6,6-tetramethyl-1-propoxypiperidin-4-yl)butyl]-1,3,5-triazinane-2,2,4-triamine.
| Compound Name | 2-N',2-N',4-N,4-N-tetrabutyl-4,6,6-trichloro-2-N-[4-(2,2,6,6-tetramethyl-1-propoxypiperidin-4-yl)butyl]-1,3,5-triazinane-2,2,4-triamine |
|---|---|
| PubChem CID | 172693045 |
| Molecular Formula | C35H72Cl3N7O |
| Molecular Weight | 713.37 g/mol |
| Exact Mass | 711.49 |
| IUPAC Name | 2-N',2-N',4-N,4-N-tetrabutyl-4,6,6-trichloro-2-N-[4-(2,2,6,6-tetramethyl-1-propoxypiperidin-4-yl)butyl]-1,3,5-triazinane-2,2,4-triamine |
| SMILES | CCCCN(CCCC)C1(Cl)NC(Cl)(Cl)NC(NCCCCC2CC(C)(C)N(OCCC)C(C)(C)C2)(N(CCCC)CCCC)N1 |
| InChI | InChI=1S/C35H72Cl3N7O/c1-10-15-23-43(24-16-11-2)34(38)40-33(36,37)41-35(42-34,44(25-17-12-3)26-18-13-4)39-22-20-19-21-30-28-31(6,7)45(46-27-14-5)32(8,9)29-30/h30,39-42H,10-29H2,1-9H3 |
| InChIKey | BYCJNJGXALGOEQ-UHFFFAOYSA-N |
| XLogP | 8.49 |
| TPSA | 67.07 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 23 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 713.37 |
| LogP ≤ 5 | 8.49 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|