C20H24N2O6S — CID 89127800
3-(3-acetamido-4-hydroxy-2,6-dimethylphenyl)-2-[(4-methylphenyl)sulfonylamino]propanoic acid (PubChem CID 89127800) has the molecular formula C20H24N2O6S and a molecular weight of 420.49 g/mol. Its IUPAC name is 3-(3-acetamido-4-hydroxy-2,6-dimethylphenyl)-2-[(4-methylphenyl)sulfonylamino]propanoic acid.
| Compound Name | 3-(3-acetamido-4-hydroxy-2,6-dimethylphenyl)-2-[(4-methylphenyl)sulfonylamino]propanoic acid |
|---|---|
| PubChem CID | 89127800 |
| Molecular Formula | C20H24N2O6S |
| Molecular Weight | 420.49 g/mol |
| Exact Mass | 420.14 |
| IUPAC Name | 3-(3-acetamido-4-hydroxy-2,6-dimethylphenyl)-2-[(4-methylphenyl)sulfonylamino]propanoic acid |
| SMILES | CC(=O)Nc1c(O)cc(C)c(CC(NS(=O)(=O)c2ccc(C)cc2)C(=O)O)c1C |
| InChI | InChI=1S/C20H24N2O6S/c1-11-5-7-15(8-6-11)29(27,28)22-17(20(25)26)10-16-12(2)9-18(24)19(13(16)3)21-14(4)23/h5-9,17,22,24H,10H2,1-4H3,(H,21,23)(H,25,26) |
| InChIKey | MHZYSLUVNLDRCI-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 132.80 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.49 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|