C16H18N2O5S — CID 69073964
(2S)-3-(3-amino-4-hydroxyphenyl)-2-[(4-methylphenyl)sulfonylamino]propanoic acid (PubChem CID 69073964) has the molecular formula C16H18N2O5S and a molecular weight of 350.40 g/mol. Its IUPAC name is (2S)-3-(3-amino-4-hydroxyphenyl)-2-[(4-methylphenyl)sulfonylamino]propanoic acid.
| Compound Name | (2S)-3-(3-amino-4-hydroxyphenyl)-2-[(4-methylphenyl)sulfonylamino]propanoic acid |
|---|---|
| PubChem CID | 69073964 |
| Molecular Formula | C16H18N2O5S |
| Molecular Weight | 350.40 g/mol |
| Exact Mass | 350.09 |
| IUPAC Name | (2S)-3-(3-amino-4-hydroxyphenyl)-2-[(4-methylphenyl)sulfonylamino]propanoic acid |
| SMILES | Cc1ccc(S(=O)(=O)N[C@@H](Cc2ccc(O)c(N)c2)C(=O)O)cc1 |
| InChI | InChI=1S/C16H18N2O5S/c1-10-2-5-12(6-3-10)24(22,23)18-14(16(20)21)9-11-4-7-15(19)13(17)8-11/h2-8,14,18-19H,9,17H2,1H3,(H,20,21)/t14-/m0/s1 |
| InChIKey | ICGOHCBTZZWHHV-AWEZNQCLSA-N |
| XLogP | 1.26 |
| TPSA | 129.72 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.40 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|