C24H29FN6O2 — CID 89127963
3-[[2-[3-[3-(dimethylamino)propyl]anilino]-5-fluoropyrimidin-4-yl]amino]-N-methoxy-N-methylbenzamide (PubChem CID 89127963) has the molecular formula C24H29FN6O2 and a molecular weight of 452.53 g/mol. Its IUPAC name is 3-[[2-[3-[3-(dimethylamino)propyl]anilino]-5-fluoropyrimidin-4-yl]amino]-N-methoxy-N-methylbenzamide.
| Compound Name | 3-[[2-[3-[3-(dimethylamino)propyl]anilino]-5-fluoropyrimidin-4-yl]amino]-N-methoxy-N-methylbenzamide |
|---|---|
| PubChem CID | 89127963 |
| Molecular Formula | C24H29FN6O2 |
| Molecular Weight | 452.53 g/mol |
| Exact Mass | 452.23 |
| IUPAC Name | 3-[[2-[3-[3-(dimethylamino)propyl]anilino]-5-fluoropyrimidin-4-yl]amino]-N-methoxy-N-methylbenzamide |
| SMILES | CON(C)C(=O)c1cccc(Nc2nc(Nc3cccc(CCCN(C)C)c3)ncc2F)c1 |
| InChI | InChI=1S/C24H29FN6O2/c1-30(2)13-7-9-17-8-5-11-19(14-17)28-24-26-16-21(25)22(29-24)27-20-12-6-10-18(15-20)23(32)31(3)33-4/h5-6,8,10-12,14-16H,7,9,13H2,1-4H3,(H2,26,27,28,29) |
| InChIKey | LGSJNDZWUNZPQX-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 82.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.53 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|