C24H31ClN4 — CID 89128073
2-chloro-6-methyl-N-[1-[4-[4-(pent-1-en-2-ylamino)phenyl]piperazin-1-yl]ethenyl]aniline (PubChem CID 89128073) has the molecular formula C24H31ClN4 and a molecular weight of 410.99 g/mol. Its IUPAC name is 2-chloro-6-methyl-N-[1-[4-[4-(pent-1-en-2-ylamino)phenyl]piperazin-1-yl]ethenyl]aniline.
| Compound Name | 2-chloro-6-methyl-N-[1-[4-[4-(pent-1-en-2-ylamino)phenyl]piperazin-1-yl]ethenyl]aniline |
|---|---|
| PubChem CID | 89128073 |
| Molecular Formula | C24H31ClN4 |
| Molecular Weight | 410.99 g/mol |
| Exact Mass | 410.22 |
| IUPAC Name | 2-chloro-6-methyl-N-[1-[4-[4-(pent-1-en-2-ylamino)phenyl]piperazin-1-yl]ethenyl]aniline |
| SMILES | C=C(CCC)Nc1ccc(N2CCN(C(=C)Nc3c(C)cccc3Cl)CC2)cc1 |
| InChI | InChI=1S/C24H31ClN4/c1-5-7-19(3)26-21-10-12-22(13-11-21)29-16-14-28(15-17-29)20(4)27-24-18(2)8-6-9-23(24)25/h6,8-13,26-27H,3-5,7,14-17H2,1-2H3 |
| InChIKey | PIWFDQXGEVAZQC-UHFFFAOYSA-N |
| XLogP | 6.08 |
| TPSA | 30.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.99 |
| LogP ≤ 5 | 6.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|