C11H14N2O4S — CID 89133553
N-[(3R,5S)-5-formyl-2-hydroxypyrrolidin-3-yl]benzenesulfonamide (PubChem CID 89133553) has the molecular formula C11H14N2O4S and a molecular weight of 270.31 g/mol. Its IUPAC name is N-[(3R,5S)-5-formyl-2-hydroxypyrrolidin-3-yl]benzenesulfonamide.
| Compound Name | N-[(3R,5S)-5-formyl-2-hydroxypyrrolidin-3-yl]benzenesulfonamide |
|---|---|
| PubChem CID | 89133553 |
| Molecular Formula | C11H14N2O4S |
| Molecular Weight | 270.31 g/mol |
| Exact Mass | 270.07 |
| IUPAC Name | N-[(3R,5S)-5-formyl-2-hydroxypyrrolidin-3-yl]benzenesulfonamide |
| SMILES | O=C[C@@H]1C[C@@H](NS(=O)(=O)c2ccccc2)C(O)N1 |
| InChI | InChI=1S/C11H14N2O4S/c14-7-8-6-10(11(15)12-8)13-18(16,17)9-4-2-1-3-5-9/h1-5,7-8,10-13,15H,6H2/t8-,10+,11?/m0/s1 |
| InChIKey | FBDSNOFJPFCXGQ-OZRKRLJNSA-N |
| XLogP | -0.79 |
| TPSA | 95.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.31 |
| LogP ≤ 5 | -0.79 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|