C26H28N2O7 — CID 89140666
[(4R,4aR,7S,7aR,12bS)-9-methoxy-3,4,12-trimethyl-1,2,4,4a,7,7a-hexahydro-[1]benzofuro[3,2-e]isoquinolin-7-yl] (4-nitrophenyl) carbonate (PubChem CID 89140666) has the molecular formula C26H28N2O7 and a molecular weight of 480.52 g/mol. Its IUPAC name is [(4R,4aR,7S,7aR,12bS)-9-methoxy-3,4,12-trimethyl-1,2,4,4a,7,7a-hexahydro-[1]benzofuro[3,2-e]isoquinolin-7-yl] (4-nitrophenyl) carbonate.
| Compound Name | [(4R,4aR,7S,7aR,12bS)-9-methoxy-3,4,12-trimethyl-1,2,4,4a,7,7a-hexahydro-[1]benzofuro[3,2-e]isoquinolin-7-yl] (4-nitrophenyl) carbonate |
|---|---|
| PubChem CID | 89140666 |
| Molecular Formula | C26H28N2O7 |
| Molecular Weight | 480.52 g/mol |
| Exact Mass | 480.19 |
| IUPAC Name | [(4R,4aR,7S,7aR,12bS)-9-methoxy-3,4,12-trimethyl-1,2,4,4a,7,7a-hexahydro-[1]benzofuro[3,2-e]isoquinolin-7-yl] (4-nitrophenyl) carbonate |
| SMILES | COc1ccc(C)c2c1O[C@H]1[C@@H](OC(=O)Oc3ccc([N+](=O)[O-])cc3)C=C[C@H]3[C@@H](C)N(C)CC[C@@]231 |
| InChI | InChI=1S/C26H28N2O7/c1-15-5-11-20(32-4)23-22(15)26-13-14-27(3)16(2)19(26)10-12-21(24(26)35-23)34-25(29)33-18-8-6-17(7-9-18)28(30)31/h5-12,16,19,21,24H,13-14H2,1-4H3/t16-,19+,21+,24+,26+/m1/s1 |
| InChIKey | PBWWJUUZUZZKQX-LDCRIIEQSA-N |
| XLogP | 4.40 |
| TPSA | 100.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.52 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'} |
|---|