C57H54O12 — CID 89146442
propanoyl 4-[4-[2-[4-[4-[2,5-dioxo-4-(2-phenylethyl)oxolan-3-yl]-2,4-diphenylbutyl]-2,5-dioxooxolan-3-yl]-2-phenylethyl]-2,5-dioxooxolan-3-yl]-4-phenylbutanoate (PubChem CID 89146442) has the molecular formula C57H54O12 and a molecular weight of 931.05 g/mol. Its IUPAC name is propanoyl 4-[4-[2-[4-[4-[2,5-dioxo-4-(2-phenylethyl)oxolan-3-yl]-2,4-diphenylbutyl]-2,5-dioxooxolan-3-yl]-2-phenylethyl]-2,5-dioxooxolan-3-yl]-4-phenylbutanoate.
| Compound Name | propanoyl 4-[4-[2-[4-[4-[2,5-dioxo-4-(2-phenylethyl)oxolan-3-yl]-2,4-diphenylbutyl]-2,5-dioxooxolan-3-yl]-2-phenylethyl]-2,5-dioxooxolan-3-yl]-4-phenylbutanoate |
|---|---|
| PubChem CID | 89146442 |
| Molecular Formula | C57H54O12 |
| Molecular Weight | 931.05 g/mol |
| Exact Mass | 930.36 |
| IUPAC Name | propanoyl 4-[4-[2-[4-[4-[2,5-dioxo-4-(2-phenylethyl)oxolan-3-yl]-2,4-diphenylbutyl]-2,5-dioxooxolan-3-yl]-2-phenylethyl]-2,5-dioxooxolan-3-yl]-4-phenylbutanoate |
| SMILES | CCC(=O)OC(=O)CCC(c1ccccc1)C1C(=O)OC(=O)C1CC(c1ccccc1)C1C(=O)OC(=O)C1CC(CC(c1ccccc1)C1C(=O)OC(=O)C1CCc1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C57H54O12/c1-2-47(58)66-48(59)31-30-41(37-22-12-5-13-23-37)49-46(54(62)69-55(49)63)34-44(39-26-16-7-17-27-39)51-45(53(61)68-57(51)65)33-40(36-20-10-4-11-21-36)32-43(38-24-14-6-15-25-38)50-42(52(60)67-56(50)64)29-28-35-18-8-3-9-19-35/h3-27,40-46,49-51H,2,28-34H2,1H3 |
| InChIKey | XKFPUNIIKSMFBR-UHFFFAOYSA-N |
| XLogP | 9.13 |
| TPSA | 173.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 69 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 931.05 |
| LogP ≤ 5 | 9.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|