C17H14N2O2 — CID 89151275
[(E)-1-azatetracyclo[7.6.1.05,16.010,15]hexadeca-5,7,9(16),10,12,14-hexaen-4-ylideneamino] acetate (PubChem CID 89151275) has the molecular formula C17H14N2O2 and a molecular weight of 278.31 g/mol. Its IUPAC name is [(E)-1-azatetracyclo[7.6.1.05,16.010,15]hexadeca-5,7,9(16),10,12,14-hexaen-4-ylideneamino] acetate.
| Compound Name | [(E)-1-azatetracyclo[7.6.1.05,16.010,15]hexadeca-5,7,9(16),10,12,14-hexaen-4-ylideneamino] acetate |
|---|---|
| PubChem CID | 89151275 |
| Molecular Formula | C17H14N2O2 |
| Molecular Weight | 278.31 g/mol |
| Exact Mass | 278.11 |
| IUPAC Name | [(E)-1-azatetracyclo[7.6.1.05,16.010,15]hexadeca-5,7,9(16),10,12,14-hexaen-4-ylideneamino] acetate |
| SMILES | CC(=O)O/N=C1\CCn2c3ccccc3c3cccc1c32 |
| InChI | InChI=1S/C17H14N2O2/c1-11(20)21-18-15-9-10-19-16-8-3-2-5-12(16)13-6-4-7-14(15)17(13)19/h2-8H,9-10H2,1H3/b18-15+ |
| InChIKey | YIKDBQQHDJOJRS-OBGWFSINSA-N |
| XLogP | 3.47 |
| TPSA | 43.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.31 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|