C19H17NO4 — CID 53497120
(10-methoxy-8-oxo-1-azatetracyclo[7.7.1.02,7.013,17]heptadeca-2,4,6,9,11,13(17)-hexaen-14-yl) acetate (PubChem CID 53497120) has the molecular formula C19H17NO4 and a molecular weight of 323.35 g/mol. Its IUPAC name is (10-methoxy-8-oxo-1-azatetracyclo[7.7.1.02,7.013,17]heptadeca-2,4,6,9,11,13(17)-hexaen-14-yl) acetate.
| Compound Name | (10-methoxy-8-oxo-1-azatetracyclo[7.7.1.02,7.013,17]heptadeca-2,4,6,9,11,13(17)-hexaen-14-yl) acetate |
|---|---|
| PubChem CID | 53497120 |
| Molecular Formula | C19H17NO4 |
| Molecular Weight | 323.35 g/mol |
| Exact Mass | 323.12 |
| IUPAC Name | (10-methoxy-8-oxo-1-azatetracyclo[7.7.1.02,7.013,17]heptadeca-2,4,6,9,11,13(17)-hexaen-14-yl) acetate |
| SMILES | COc1ccc2c3c1c(=O)c1ccccc1n3CCC2OC(C)=O |
| InChI | InChI=1S/C19H17NO4/c1-11(21)24-15-9-10-20-14-6-4-3-5-12(14)19(22)17-16(23-2)8-7-13(15)18(17)20/h3-8,15H,9-10H2,1-2H3 |
| InChIKey | NMWGBSGHROQHEM-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 57.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.35 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|