C22H23NO6 — CID 102137017
[(4R)-5-hydroxy-12-methoxy-2,2,11-trimethyl-6-oxo-3,4-dihydropyrano[3,2-b]acridin-4-yl] acetate (PubChem CID 102137017) has the molecular formula C22H23NO6 and a molecular weight of 397.43 g/mol. Its IUPAC name is [(4R)-5-hydroxy-12-methoxy-2,2,11-trimethyl-6-oxo-3,4-dihydropyrano[3,2-b]acridin-4-yl] acetate.
| Compound Name | [(4R)-5-hydroxy-12-methoxy-2,2,11-trimethyl-6-oxo-3,4-dihydropyrano[3,2-b]acridin-4-yl] acetate |
|---|---|
| PubChem CID | 102137017 |
| Molecular Formula | C22H23NO6 |
| Molecular Weight | 397.43 g/mol |
| Exact Mass | 397.15 |
| IUPAC Name | [(4R)-5-hydroxy-12-methoxy-2,2,11-trimethyl-6-oxo-3,4-dihydropyrano[3,2-b]acridin-4-yl] acetate |
| SMILES | COc1c2c(c(O)c3c(=O)c4ccccc4n(C)c13)[C@H](OC(C)=O)CC(C)(C)O2 |
| InChI | InChI=1S/C22H23NO6/c1-11(24)28-14-10-22(2,3)29-20-15(14)19(26)16-17(21(20)27-5)23(4)13-9-7-6-8-12(13)18(16)25/h6-9,14,26H,10H2,1-5H3/t14-/m1/s1 |
| InChIKey | HSEDQCHQNKXVER-CQSZACIVSA-N |
| XLogP | 3.57 |
| TPSA | 86.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.43 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|