C16H15NO5 — CID 102480133
1,3-dihydroxy-2,4-dimethoxy-10-methylacridin-9-one (PubChem CID 102480133) has the molecular formula C16H15NO5 and a molecular weight of 301.30 g/mol. Its IUPAC name is 1,3-dihydroxy-2,4-dimethoxy-10-methylacridin-9-one.
| Compound Name | 1,3-dihydroxy-2,4-dimethoxy-10-methylacridin-9-one |
|---|---|
| PubChem CID | 102480133 |
| Molecular Formula | C16H15NO5 |
| Molecular Weight | 301.30 g/mol |
| Exact Mass | 301.10 |
| IUPAC Name | 1,3-dihydroxy-2,4-dimethoxy-10-methylacridin-9-one |
| SMILES | COc1c(O)c(OC)c2c(c1O)c(=O)c1ccccc1n2C |
| InChI | InChI=1S/C16H15NO5/c1-17-9-7-5-4-6-8(9)12(18)10-11(17)15(21-2)14(20)16(22-3)13(10)19/h4-7,19-20H,1-3H3 |
| InChIKey | WHMCLWSSPJMKDA-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 80.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.30 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|