About [4-[(E)-2-(3,5-dimethoxyphenyl)ethenyl]phenyl] 5-acetyloxy-2-[(dihydroxyamino)oxymethyl]benzoate
[4-[(E)-2-(3,5-dimethoxyphenyl)ethenyl]phenyl] 5-acetyloxy-2-[(dihydroxyamino)oxymethyl]benzoate (PubChem CID 89151556) has the molecular formula C26H25NO9
and a molecular weight of 495.48 g/mol. Its IUPAC name is [4-[(E)-2-(3,5-dimethoxyphenyl)ethenyl]phenyl] 5-acetyloxy-2-[(dihydroxyamino)oxymethyl]benzoate.
Molecular Properties
| Compound Name | [4-[(E)-2-(3,5-dimethoxyphenyl)ethenyl]phenyl] 5-acetyloxy-2-[(dihydroxyamino)oxymethyl]benzoate |
| PubChem CID | 89151556 |
| Molecular Formula | C26H25NO9 |
| Molecular Weight | 495.48 g/mol |
| Exact Mass | 495.15 |
| IUPAC Name | [4-[(E)-2-(3,5-dimethoxyphenyl)ethenyl]phenyl] 5-acetyloxy-2-[(dihydroxyamino)oxymethyl]benzoate |
| SMILES | COc1cc(/C=C/c2ccc(OC(=O)c3cc(OC(C)=O)ccc3CON(O)O)cc2)cc(OC)c1 |
| InChI | InChI=1S/C26H25NO9/c1-17(28)35-22-11-8-20(16-34-27(30)31)25(15-22)26(29)36-21-9-6-18(7-10-21)4-5-19-12-23(32-2)14-24(13-19)33-3/h4-15,30-31H,16H2,1-3H3/b5-4+ |
| InChIKey | ZOMRCCVPAMYVDG-SNAWJCMRSA-N |
| XLogP | 4.53 |
| TPSA | 123.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 495.48 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|
Analyze [4-[(E)-2-(3,5-dimethoxyphenyl)ethenyl]phenyl] 5-acetyloxy-2-[(dihydroxyamino)oxymethyl]benzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4-[(E)-2-(3,5-dimethoxyphenyl)ethenyl]phenyl] 5-acetyloxy-2-[(dihydroxyamino)oxymethyl]benzoate?
The IUPAC name of [4-[(E)-2-(3,5-dimethoxyphenyl)ethenyl]phenyl] 5-acetyloxy-2-[(dihydroxyamino)oxymethyl]benzoate (CID 89151556) is [4-[(E)-2-(3,5-dimethoxyphenyl)ethenyl]phenyl] 5-acetyloxy-2-[(dihydroxyamino)oxymethyl]benzoate.
What is the SMILES notation for [4-[(E)-2-(3,5-dimethoxyphenyl)ethenyl]phenyl] 5-acetyloxy-2-[(dihydroxyamino)oxymethyl]benzoate?
The canonical SMILES for [4-[(E)-2-(3,5-dimethoxyphenyl)ethenyl]phenyl] 5-acetyloxy-2-[(dihydroxyamino)oxymethyl]benzoate is COc1cc(/C=C/c2ccc(OC(=O)c3cc(OC(C)=O)ccc3CON(O)O)cc2)cc(OC)c1.
What is the InChIKey of [4-[(E)-2-(3,5-dimethoxyphenyl)ethenyl]phenyl] 5-acetyloxy-2-[(dihydroxyamino)oxymethyl]benzoate?
The InChIKey is ZOMRCCVPAMYVDG-SNAWJCMRSA-N. The full InChI is InChI=1S/C26H25NO9/c1-17(28)35-22-11-8-20(16-34-27(30)31)25(15-22)26(29)36-21-9-6-18(7-10-21)4-5-19-12-23(32-2)14-24(13-19)33-3/h4-15,30-31H,16H2,1-3H3/b5-4+.
What are the key properties of [4-[(E)-2-(3,5-dimethoxyphenyl)ethenyl]phenyl] 5-acetyloxy-2-[(dihydroxyamino)oxymethyl]benzoate?
[4-[(E)-2-(3,5-dimethoxyphenyl)ethenyl]phenyl] 5-acetyloxy-2-[(dihydroxyamino)oxymethyl]benzoate has a molecular weight of 495.48 g/mol, XLogP of 4.53, 10 rotatable bonds, 2 hydrogen bond donors, and 10 hydrogen bond acceptors.
Where does this data come from?
All data for [4-[(E)-2-(3,5-dimethoxyphenyl)ethenyl]phenyl] 5-acetyloxy-2-[(dihydroxyamino)oxymethyl]benzoate is sourced from PubChem (CID 89151556), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).