C12H12ClNO2 — CID 89156961
3-(4-chlorophenyl)-5,5-dimethyl-4H-1,2-oxazole-4-carbaldehyde (PubChem CID 89156961) has the molecular formula C12H12ClNO2 and a molecular weight of 237.69 g/mol. Its IUPAC name is 3-(4-chlorophenyl)-5,5-dimethyl-4H-1,2-oxazole-4-carbaldehyde.
| Compound Name | 3-(4-chlorophenyl)-5,5-dimethyl-4H-1,2-oxazole-4-carbaldehyde |
|---|---|
| PubChem CID | 89156961 |
| Molecular Formula | C12H12ClNO2 |
| Molecular Weight | 237.69 g/mol |
| Exact Mass | 237.06 |
| IUPAC Name | 3-(4-chlorophenyl)-5,5-dimethyl-4H-1,2-oxazole-4-carbaldehyde |
| SMILES | CC1(C)ON=C(c2ccc(Cl)cc2)C1C=O |
| InChI | InChI=1S/C12H12ClNO2/c1-12(2)10(7-15)11(14-16-12)8-3-5-9(13)6-4-8/h3-7,10H,1-2H3 |
| InChIKey | BSAXNDULNJUERD-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 38.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.69 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|