About 3-(4-chlorophenyl)-5,5-dimethyl-4H-1,2-oxazole-4-carbaldehyde
3-(4-chlorophenyl)-5,5-dimethyl-4H-1,2-oxazole-4-carbaldehyde (PubChem CID 89156961) has the molecular formula C12H12ClNO2
and a molecular weight of 237.69 g/mol. Its IUPAC name is 3-(4-chlorophenyl)-5,5-dimethyl-4H-1,2-oxazole-4-carbaldehyde.
Molecular Properties
| Compound Name | 3-(4-chlorophenyl)-5,5-dimethyl-4H-1,2-oxazole-4-carbaldehyde |
| PubChem CID | 89156961 |
| Molecular Formula | C12H12ClNO2 |
| Molecular Weight | 237.69 g/mol |
| Exact Mass | 237.06 |
| IUPAC Name | 3-(4-chlorophenyl)-5,5-dimethyl-4H-1,2-oxazole-4-carbaldehyde |
| SMILES | CC1(C)ON=C(c2ccc(Cl)cc2)C1C=O |
| InChI | InChI=1S/C12H12ClNO2/c1-12(2)10(7-15)11(14-16-12)8-3-5-9(13)6-4-8/h3-7,10H,1-2H3 |
| InChIKey | BSAXNDULNJUERD-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 38.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 237.69 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze 3-(4-chlorophenyl)-5,5-dimethyl-4H-1,2-oxazole-4-carbaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(4-chlorophenyl)-5,5-dimethyl-4H-1,2-oxazole-4-carbaldehyde?
The IUPAC name of 3-(4-chlorophenyl)-5,5-dimethyl-4H-1,2-oxazole-4-carbaldehyde (CID 89156961) is 3-(4-chlorophenyl)-5,5-dimethyl-4H-1,2-oxazole-4-carbaldehyde.
What is the SMILES notation for 3-(4-chlorophenyl)-5,5-dimethyl-4H-1,2-oxazole-4-carbaldehyde?
The canonical SMILES for 3-(4-chlorophenyl)-5,5-dimethyl-4H-1,2-oxazole-4-carbaldehyde is CC1(C)ON=C(c2ccc(Cl)cc2)C1C=O.
What is the InChIKey of 3-(4-chlorophenyl)-5,5-dimethyl-4H-1,2-oxazole-4-carbaldehyde?
The InChIKey is BSAXNDULNJUERD-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H12ClNO2/c1-12(2)10(7-15)11(14-16-12)8-3-5-9(13)6-4-8/h3-7,10H,1-2H3.
What are the key properties of 3-(4-chlorophenyl)-5,5-dimethyl-4H-1,2-oxazole-4-carbaldehyde?
3-(4-chlorophenyl)-5,5-dimethyl-4H-1,2-oxazole-4-carbaldehyde has a molecular weight of 237.69 g/mol, XLogP of 2.67, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(4-chlorophenyl)-5,5-dimethyl-4H-1,2-oxazole-4-carbaldehyde is sourced from PubChem (CID 89156961), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).