C55H64BrN — CID 89166887
4-(13-bromo-1,1,4,4,8,8,11,11-octamethyl-2,3,9,10-tetrahydropentacen-6-yl)-N-(4-tert-butylphenyl)-N-(4-propan-2-ylphenyl)aniline (PubChem CID 89166887) has the molecular formula C55H64BrN and a molecular weight of 819.03 g/mol. Its IUPAC name is 4-(13-bromo-1,1,4,4,8,8,11,11-octamethyl-2,3,9,10-tetrahydropentacen-6-yl)-N-(4-tert-butylphenyl)-N-(4-propan-2-ylphenyl)aniline.
| Compound Name | 4-(13-bromo-1,1,4,4,8,8,11,11-octamethyl-2,3,9,10-tetrahydropentacen-6-yl)-N-(4-tert-butylphenyl)-N-(4-propan-2-ylphenyl)aniline |
|---|---|
| PubChem CID | 89166887 |
| Molecular Formula | C55H64BrN |
| Molecular Weight | 819.03 g/mol |
| Exact Mass | 817.42 |
| IUPAC Name | 4-(13-bromo-1,1,4,4,8,8,11,11-octamethyl-2,3,9,10-tetrahydropentacen-6-yl)-N-(4-tert-butylphenyl)-N-(4-propan-2-ylphenyl)aniline |
| SMILES | CC(C)c1ccc(N(c2ccc(-c3c4cc5c(cc4c(Br)c4cc6c(cc34)C(C)(C)CCC6(C)C)C(C)(C)CCC5(C)C)cc2)c2ccc(C(C)(C)C)cc2)cc1 |
| InChI | InChI=1S/C55H64BrN/c1-34(2)35-14-20-38(21-15-35)57(40-24-18-37(19-25-40)51(3,4)5)39-22-16-36(17-23-39)49-41-30-45-47(54(10,11)28-26-52(45,6)7)32-43(41)50(56)44-33-48-46(31-42(44)49)53(8,9)27-29-55(48,12)13/h14-25,30-34H,26-29H2,1-13H3 |
| InChIKey | FWQDQWUQMFCVHD-UHFFFAOYSA-N |
| XLogP | 17.01 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 57 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 819.03 |
| LogP ≤ 5 | 17.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|