About (2E)-2-[(Z)-2-(4-iodocyclohex-3-en-1-yl)pent-2-enylidene]-3,3-dimethyl-1H-indene
(2E)-2-[(Z)-2-(4-iodocyclohex-3-en-1-yl)pent-2-enylidene]-3,3-dimethyl-1H-indene (PubChem CID 89170940) has the molecular formula C22H27I
and a molecular weight of 418.36 g/mol. Its IUPAC name is (2E)-2-[(Z)-2-(4-iodocyclohex-3-en-1-yl)pent-2-enylidene]-3,3-dimethyl-1H-indene.
Molecular Properties
| Compound Name | (2E)-2-[(Z)-2-(4-iodocyclohex-3-en-1-yl)pent-2-enylidene]-3,3-dimethyl-1H-indene |
| PubChem CID | 89170940 |
| Molecular Formula | C22H27I |
| Molecular Weight | 418.36 g/mol |
| Exact Mass | 418.12 |
| IUPAC Name | (2E)-2-[(Z)-2-(4-iodocyclohex-3-en-1-yl)pent-2-enylidene]-3,3-dimethyl-1H-indene |
| SMILES | CC/C=C(\C=C1/Cc2ccccc2C1(C)C)C1CC=C(I)CC1 |
| InChI | InChI=1S/C22H27I/c1-4-7-17(16-10-12-20(23)13-11-16)14-19-15-18-8-5-6-9-21(18)22(19,2)3/h5-9,12,14,16H,4,10-11,13,15H2,1-3H3/b17-7+,19-14+ |
| InChIKey | VHKUYZSDTVNYLQ-BBXNZBFESA-N |
| XLogP | 6.90 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 418.36 |
| LogP ≤ 5 | 6.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze (2E)-2-[(Z)-2-(4-iodocyclohex-3-en-1-yl)pent-2-enylidene]-3,3-dimethyl-1H-indene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2E)-2-[(Z)-2-(4-iodocyclohex-3-en-1-yl)pent-2-enylidene]-3,3-dimethyl-1H-indene?
The IUPAC name of (2E)-2-[(Z)-2-(4-iodocyclohex-3-en-1-yl)pent-2-enylidene]-3,3-dimethyl-1H-indene (CID 89170940) is (2E)-2-[(Z)-2-(4-iodocyclohex-3-en-1-yl)pent-2-enylidene]-3,3-dimethyl-1H-indene.
What is the SMILES notation for (2E)-2-[(Z)-2-(4-iodocyclohex-3-en-1-yl)pent-2-enylidene]-3,3-dimethyl-1H-indene?
The canonical SMILES for (2E)-2-[(Z)-2-(4-iodocyclohex-3-en-1-yl)pent-2-enylidene]-3,3-dimethyl-1H-indene is CC/C=C(\C=C1/Cc2ccccc2C1(C)C)C1CC=C(I)CC1.
What is the InChIKey of (2E)-2-[(Z)-2-(4-iodocyclohex-3-en-1-yl)pent-2-enylidene]-3,3-dimethyl-1H-indene?
The InChIKey is VHKUYZSDTVNYLQ-BBXNZBFESA-N. The full InChI is InChI=1S/C22H27I/c1-4-7-17(16-10-12-20(23)13-11-16)14-19-15-18-8-5-6-9-21(18)22(19,2)3/h5-9,12,14,16H,4,10-11,13,15H2,1-3H3/b17-7+,19-14+.
What are the key properties of (2E)-2-[(Z)-2-(4-iodocyclohex-3-en-1-yl)pent-2-enylidene]-3,3-dimethyl-1H-indene?
(2E)-2-[(Z)-2-(4-iodocyclohex-3-en-1-yl)pent-2-enylidene]-3,3-dimethyl-1H-indene has a molecular weight of 418.36 g/mol, XLogP of 6.90, 3 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for (2E)-2-[(Z)-2-(4-iodocyclohex-3-en-1-yl)pent-2-enylidene]-3,3-dimethyl-1H-indene is sourced from PubChem (CID 89170940), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).