C30H45N3O5 — CID 89171509
4-[2-[4-[4-[(2-methoxy-2-adamantyl)peroxy]cyclohexyl]phenoxy]ethyl]piperazine-1-carboxamide (PubChem CID 89171509) has the molecular formula C30H45N3O5 and a molecular weight of 527.71 g/mol. Its IUPAC name is 4-[2-[4-[4-[(2-methoxy-2-adamantyl)peroxy]cyclohexyl]phenoxy]ethyl]piperazine-1-carboxamide.
| Compound Name | 4-[2-[4-[4-[(2-methoxy-2-adamantyl)peroxy]cyclohexyl]phenoxy]ethyl]piperazine-1-carboxamide |
|---|---|
| PubChem CID | 89171509 |
| Molecular Formula | C30H45N3O5 |
| Molecular Weight | 527.71 g/mol |
| Exact Mass | 527.34 |
| IUPAC Name | 4-[2-[4-[4-[(2-methoxy-2-adamantyl)peroxy]cyclohexyl]phenoxy]ethyl]piperazine-1-carboxamide |
| SMILES | COC1(OOC2CCC(c3ccc(OCCN4CCN(C(N)=O)CC4)cc3)CC2)C2CC3CC(C2)CC1C3 |
| InChI | InChI=1S/C30H45N3O5/c1-35-30(25-17-21-16-22(19-25)20-26(30)18-21)38-37-28-8-4-24(5-9-28)23-2-6-27(7-3-23)36-15-14-32-10-12-33(13-11-32)29(31)34/h2-3,6-7,21-22,24-26,28H,4-5,8-20H2,1H3,(H2,31,34) |
| InChIKey | YXXBUYVELXFAFP-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 86.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.71 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|