C28H29F3N2O2 — CID 89178743
5-(dimethylamino)-2-[(E)-2-[3-[(E)-2-[4-(dimethylamino)-2-hydroxyphenyl]ethenyl]-2-(2,2,2-trifluoroethyl)phenyl]ethenyl]phenol (PubChem CID 89178743) has the molecular formula C28H29F3N2O2 and a molecular weight of 482.55 g/mol. Its IUPAC name is 5-(dimethylamino)-2-[(E)-2-[3-[(E)-2-[4-(dimethylamino)-2-hydroxyphenyl]ethenyl]-2-(2,2,2-trifluoroethyl)phenyl]ethenyl]phenol.
| Compound Name | 5-(dimethylamino)-2-[(E)-2-[3-[(E)-2-[4-(dimethylamino)-2-hydroxyphenyl]ethenyl]-2-(2,2,2-trifluoroethyl)phenyl]ethenyl]phenol |
|---|---|
| PubChem CID | 89178743 |
| Molecular Formula | C28H29F3N2O2 |
| Molecular Weight | 482.55 g/mol |
| Exact Mass | 482.22 |
| IUPAC Name | 5-(dimethylamino)-2-[(E)-2-[3-[(E)-2-[4-(dimethylamino)-2-hydroxyphenyl]ethenyl]-2-(2,2,2-trifluoroethyl)phenyl]ethenyl]phenol |
| SMILES | CN(C)c1ccc(/C=C/c2cccc(/C=C/c3ccc(N(C)C)cc3O)c2CC(F)(F)F)c(O)c1 |
| InChI | InChI=1S/C28H29F3N2O2/c1-32(2)23-14-12-21(26(34)16-23)10-8-19-6-5-7-20(25(19)18-28(29,30)31)9-11-22-13-15-24(33(3)4)17-27(22)35/h5-17,34-35H,18H2,1-4H3/b10-8+,11-9+ |
| InChIKey | LMFOFTSPGJHFJN-GFULKKFKSA-N |
| XLogP | 6.68 |
| TPSA | 46.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.55 |
| LogP ≤ 5 | 6.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|