C8H11N3O4S — CID 89179009
(3,4-diaminophenyl)sulfonyl-methylcarbamic acid (PubChem CID 89179009) has the molecular formula C8H11N3O4S and a molecular weight of 245.26 g/mol. Its IUPAC name is (3,4-diaminophenyl)sulfonyl-methylcarbamic acid.
| Compound Name | (3,4-diaminophenyl)sulfonyl-methylcarbamic acid |
|---|---|
| PubChem CID | 89179009 |
| Molecular Formula | C8H11N3O4S |
| Molecular Weight | 245.26 g/mol |
| Exact Mass | 245.05 |
| IUPAC Name | (3,4-diaminophenyl)sulfonyl-methylcarbamic acid |
| SMILES | CN(C(=O)O)S(=O)(=O)c1ccc(N)c(N)c1 |
| InChI | InChI=1S/C8H11N3O4S/c1-11(8(12)13)16(14,15)5-2-3-6(9)7(10)4-5/h2-4H,9-10H2,1H3,(H,12,13) |
| InChIKey | FKOUNDHKAHOWIB-UHFFFAOYSA-N |
| XLogP | 0.15 |
| TPSA | 126.72 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.26 |
| LogP ≤ 5 | 0.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|