C21H32O4 — CID 89183361
[2-hydroxy-3-(4-nonan-4-ylphenoxy)propyl] prop-2-enoate (PubChem CID 89183361) has the molecular formula C21H32O4 and a molecular weight of 348.48 g/mol. Its IUPAC name is [2-hydroxy-3-(4-nonan-4-ylphenoxy)propyl] prop-2-enoate.
| Compound Name | [2-hydroxy-3-(4-nonan-4-ylphenoxy)propyl] prop-2-enoate |
|---|---|
| PubChem CID | 89183361 |
| Molecular Formula | C21H32O4 |
| Molecular Weight | 348.48 g/mol |
| Exact Mass | 348.23 |
| IUPAC Name | [2-hydroxy-3-(4-nonan-4-ylphenoxy)propyl] prop-2-enoate |
| SMILES | C=CC(=O)OCC(O)COc1ccc(C(CCC)CCCCC)cc1 |
| InChI | InChI=1S/C21H32O4/c1-4-7-8-10-17(9-5-2)18-11-13-20(14-12-18)24-15-19(22)16-25-21(23)6-3/h6,11-14,17,19,22H,3-5,7-10,15-16H2,1-2H3 |
| InChIKey | QYZCEWMCCPGTHJ-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.48 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|