C9H16N2 — CID 89187863
(1E,3E)-3,6-dimethylhepta-1,3,5-triene-1,4-diamine (PubChem CID 89187863) has the molecular formula C9H16N2 and a molecular weight of 152.24 g/mol. Its IUPAC name is (1E,3E)-3,6-dimethylhepta-1,3,5-triene-1,4-diamine.
| Compound Name | (1E,3E)-3,6-dimethylhepta-1,3,5-triene-1,4-diamine |
|---|---|
| PubChem CID | 89187863 |
| Molecular Formula | C9H16N2 |
| Molecular Weight | 152.24 g/mol |
| Exact Mass | 152.13 |
| IUPAC Name | (1E,3E)-3,6-dimethylhepta-1,3,5-triene-1,4-diamine |
| SMILES | CC(C)=C/C(N)=C(C)\C=C\N |
| InChI | InChI=1S/C9H16N2/c1-7(2)6-9(11)8(3)4-5-10/h4-6H,10-11H2,1-3H3/b5-4+,9-8+ |
| InChIKey | OMOPIZNNUXEOND-KQWYESAVSA-N |
| XLogP | 1.66 |
| TPSA | 52.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 152.24 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|