C30H33N3O3S2 — CID 89200228
2-[8-(furan-2-ylmethylamino)-8-sulfanylideneoctan-4-yl]-N-(5-methoxy-2-phenylphenyl)-1,3-thiazole-4-carboxamide (PubChem CID 89200228) has the molecular formula C30H33N3O3S2 and a molecular weight of 547.75 g/mol. Its IUPAC name is 2-[8-(furan-2-ylmethylamino)-8-sulfanylideneoctan-4-yl]-N-(5-methoxy-2-phenylphenyl)-1,3-thiazole-4-carboxamide.
| Compound Name | 2-[8-(furan-2-ylmethylamino)-8-sulfanylideneoctan-4-yl]-N-(5-methoxy-2-phenylphenyl)-1,3-thiazole-4-carboxamide |
|---|---|
| PubChem CID | 89200228 |
| Molecular Formula | C30H33N3O3S2 |
| Molecular Weight | 547.75 g/mol |
| Exact Mass | 547.20 |
| IUPAC Name | 2-[8-(furan-2-ylmethylamino)-8-sulfanylideneoctan-4-yl]-N-(5-methoxy-2-phenylphenyl)-1,3-thiazole-4-carboxamide |
| SMILES | CCCC(CCCC(=S)NCc1ccco1)c1nc(C(=O)Nc2cc(OC)ccc2-c2ccccc2)cs1 |
| InChI | InChI=1S/C30H33N3O3S2/c1-3-9-22(12-7-14-28(37)31-19-24-13-8-17-36-24)30-33-27(20-38-30)29(34)32-26-18-23(35-2)15-16-25(26)21-10-5-4-6-11-21/h4-6,8,10-11,13,15-18,20,22H,3,7,9,12,14,19H2,1-2H3,(H,31,37)(H,32,34) |
| InChIKey | FOBYYZPZDFVLCN-UHFFFAOYSA-N |
| XLogP | 7.84 |
| TPSA | 76.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 547.75 |
| LogP ≤ 5 | 7.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|