C26H27NO3S — CID 89212804
ethyl 7-methylidene-5-oxo-4-(5-phenylthiophen-2-yl)-2-propyl-4,8-dihydro-1H-quinoline-3-carboxylate (PubChem CID 89212804) has the molecular formula C26H27NO3S and a molecular weight of 433.57 g/mol. Its IUPAC name is ethyl 7-methylidene-5-oxo-4-(5-phenylthiophen-2-yl)-2-propyl-4,8-dihydro-1H-quinoline-3-carboxylate.
| Compound Name | ethyl 7-methylidene-5-oxo-4-(5-phenylthiophen-2-yl)-2-propyl-4,8-dihydro-1H-quinoline-3-carboxylate |
|---|---|
| PubChem CID | 89212804 |
| Molecular Formula | C26H27NO3S |
| Molecular Weight | 433.57 g/mol |
| Exact Mass | 433.17 |
| IUPAC Name | ethyl 7-methylidene-5-oxo-4-(5-phenylthiophen-2-yl)-2-propyl-4,8-dihydro-1H-quinoline-3-carboxylate |
| SMILES | C=C1CC(=O)C2=C(C1)NC(CCC)=C(C(=O)OCC)C2c1ccc(-c2ccccc2)s1 |
| InChI | InChI=1S/C26H27NO3S/c1-4-9-18-24(26(29)30-5-2)25(23-19(27-18)14-16(3)15-20(23)28)22-13-12-21(31-22)17-10-7-6-8-11-17/h6-8,10-13,25,27H,3-5,9,14-15H2,1-2H3 |
| InChIKey | ZHMMDIFMZVSASN-UHFFFAOYSA-N |
| XLogP | 5.89 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.57 |
| LogP ≤ 5 | 5.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|