C7H5Br2Y- — CID 89213379
2,4-dibromo-1-methylbenzene-5-ide;yttrium (PubChem CID 89213379) has the molecular formula C7H5Br2Y- and a molecular weight of 337.83 g/mol. Its IUPAC name is 2,4-dibromo-1-methylbenzene-5-ide;yttrium.
| Compound Name | 2,4-dibromo-1-methylbenzene-5-ide;yttrium |
|---|---|
| PubChem CID | 89213379 |
| Molecular Formula | C7H5Br2Y- |
| Molecular Weight | 337.83 g/mol |
| Exact Mass | 335.78 |
| IUPAC Name | 2,4-dibromo-1-methylbenzene-5-ide;yttrium |
| SMILES | Cc1c[c-]c(Br)cc1Br.[Y] |
| InChI | InChI=1S/C7H5Br2.Y/c1-5-2-3-6(8)4-7(5)9;/h2,4H,1H3;/q-1; |
| InChIKey | TZHPRARXBTVHGF-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.83 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|