C24H25ClN4O2S — CID 89213751
2-chloro-N-[1-oxo-2-[(1-pyridin-4-ylpiperidin-4-yl)methyl]-3H-isoindol-4-yl]-2,3-dihydrothiophene-5-carboxamide (PubChem CID 89213751) has the molecular formula C24H25ClN4O2S and a molecular weight of 469.01 g/mol. Its IUPAC name is 2-chloro-N-[1-oxo-2-[(1-pyridin-4-ylpiperidin-4-yl)methyl]-3H-isoindol-4-yl]-2,3-dihydrothiophene-5-carboxamide.
| Compound Name | 2-chloro-N-[1-oxo-2-[(1-pyridin-4-ylpiperidin-4-yl)methyl]-3H-isoindol-4-yl]-2,3-dihydrothiophene-5-carboxamide |
|---|---|
| PubChem CID | 89213751 |
| Molecular Formula | C24H25ClN4O2S |
| Molecular Weight | 469.01 g/mol |
| Exact Mass | 468.14 |
| IUPAC Name | 2-chloro-N-[1-oxo-2-[(1-pyridin-4-ylpiperidin-4-yl)methyl]-3H-isoindol-4-yl]-2,3-dihydrothiophene-5-carboxamide |
| SMILES | O=C(Nc1cccc2c1CN(CC1CCN(c3ccncc3)CC1)C2=O)C1=CCC(Cl)S1 |
| InChI | InChI=1S/C24H25ClN4O2S/c25-22-5-4-21(32-22)23(30)27-20-3-1-2-18-19(20)15-29(24(18)31)14-16-8-12-28(13-9-16)17-6-10-26-11-7-17/h1-4,6-7,10-11,16,22H,5,8-9,12-15H2,(H,27,30) |
| InChIKey | CUXPAIICAQOIBG-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 65.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.01 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|