C33H36F2N2O5 — CID 89216755
benzyl (2S)-5-acetamido-2-[[(1R)-1-[3,5-bis(fluoromethyl)phenyl]ethoxy]methyl]-5-formyl-2-phenylpiperidine-1-carboxylate (PubChem CID 89216755) has the molecular formula C33H36F2N2O5 and a molecular weight of 578.66 g/mol. Its IUPAC name is benzyl (2S)-5-acetamido-2-[[(1R)-1-[3,5-bis(fluoromethyl)phenyl]ethoxy]methyl]-5-formyl-2-phenylpiperidine-1-carboxylate.
| Compound Name | benzyl (2S)-5-acetamido-2-[[(1R)-1-[3,5-bis(fluoromethyl)phenyl]ethoxy]methyl]-5-formyl-2-phenylpiperidine-1-carboxylate |
|---|---|
| PubChem CID | 89216755 |
| Molecular Formula | C33H36F2N2O5 |
| Molecular Weight | 578.66 g/mol |
| Exact Mass | 578.26 |
| IUPAC Name | benzyl (2S)-5-acetamido-2-[[(1R)-1-[3,5-bis(fluoromethyl)phenyl]ethoxy]methyl]-5-formyl-2-phenylpiperidine-1-carboxylate |
| SMILES | CC(=O)NC1(C=O)CC[C@@](CO[C@H](C)c2cc(CF)cc(CF)c2)(c2ccccc2)N(C(=O)OCc2ccccc2)C1 |
| InChI | InChI=1S/C33H36F2N2O5/c1-24(29-16-27(18-34)15-28(17-29)19-35)42-23-33(30-11-7-4-8-12-30)14-13-32(22-38,36-25(2)39)21-37(33)31(40)41-20-26-9-5-3-6-10-26/h3-12,15-17,22,24H,13-14,18-21,23H2,1-2H3,(H,36,39)/t24-,32?,33-/m1/s1 |
| InChIKey | MBXNCZMMNGLCAS-SOIGKGITSA-N |
| XLogP | 6.11 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 578.66 |
| LogP ≤ 5 | 6.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|