C33H35N7O3 — CID 89229242
(6S,9aS)-N-benzyl-6-[(4-hydroxyphenyl)methyl]-2-methyl-4-oxo-8-[(2-prop-2-ynylindazol-7-yl)methyl]-6,7,9,9a-tetrahydro-3H-pyrazino[2,1-c][1,2,4]triazine-1-carboxamide (PubChem CID 89229242) has the molecular formula C33H35N7O3 and a molecular weight of 577.69 g/mol. Its IUPAC name is (6S,9aS)-N-benzyl-6-[(4-hydroxyphenyl)methyl]-2-methyl-4-oxo-8-[(2-prop-2-ynylindazol-7-yl)methyl]-6,7,9,9a-tetrahydro-3H-pyrazino[2,1-c][1,2,4]triazine-1-carboxamide.
| Compound Name | (6S,9aS)-N-benzyl-6-[(4-hydroxyphenyl)methyl]-2-methyl-4-oxo-8-[(2-prop-2-ynylindazol-7-yl)methyl]-6,7,9,9a-tetrahydro-3H-pyrazino[2,1-c][1,2,4]triazine-1-carboxamide |
|---|---|
| PubChem CID | 89229242 |
| Molecular Formula | C33H35N7O3 |
| Molecular Weight | 577.69 g/mol |
| Exact Mass | 577.28 |
| IUPAC Name | (6S,9aS)-N-benzyl-6-[(4-hydroxyphenyl)methyl]-2-methyl-4-oxo-8-[(2-prop-2-ynylindazol-7-yl)methyl]-6,7,9,9a-tetrahydro-3H-pyrazino[2,1-c][1,2,4]triazine-1-carboxamide |
| SMILES | C#CCn1cc2cccc(CN3C[C@H](Cc4ccc(O)cc4)N4C(=O)CN(C)N(C(=O)NCc5ccccc5)[C@H]4C3)c2n1 |
| InChI | InChI=1S/C33H35N7O3/c1-3-16-38-20-27-11-7-10-26(32(27)35-38)19-37-21-28(17-24-12-14-29(41)15-13-24)39-30(22-37)40(36(2)23-31(39)42)33(43)34-18-25-8-5-4-6-9-25/h1,4-15,20,28,30,41H,16-19,21-23H2,2H3,(H,34,43)/t28-,30-/m0/s1 |
| InChIKey | JYVJKXQPIOGPFB-JDXGNMNLSA-N |
| XLogP | 3.03 |
| TPSA | 97.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 577.69 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|