C28H27FN2O4 — CID 89252461
(3R,11S,15R,16S,24S)-21-fluoro-9-methyl-14-prop-2-enyl-4-oxa-1,14-diazaoctacyclo[17.7.1.02,18.03,11.05,10.011,16.013,15.023,27]heptacosa-2(18),5,7,9,19(27),20,22-heptaene-6,16,24-triol (PubChem CID 89252461) has the molecular formula C28H27FN2O4 and a molecular weight of 474.53 g/mol. Its IUPAC name is (3R,11S,15R,16S,24S)-21-fluoro-9-methyl-14-prop-2-enyl-4-oxa-1,14-diazaoctacyclo[17.7.1.02,18.03,11.05,10.011,16.013,15.023,27]heptacosa-2(18),5,7,9,19(27),20,22-heptaene-6,16,24-triol.
| Compound Name | (3R,11S,15R,16S,24S)-21-fluoro-9-methyl-14-prop-2-enyl-4-oxa-1,14-diazaoctacyclo[17.7.1.02,18.03,11.05,10.011,16.013,15.023,27]heptacosa-2(18),5,7,9,19(27),20,22-heptaene-6,16,24-triol |
|---|---|
| PubChem CID | 89252461 |
| Molecular Formula | C28H27FN2O4 |
| Molecular Weight | 474.53 g/mol |
| Exact Mass | 474.20 |
| IUPAC Name | (3R,11S,15R,16S,24S)-21-fluoro-9-methyl-14-prop-2-enyl-4-oxa-1,14-diazaoctacyclo[17.7.1.02,18.03,11.05,10.011,16.013,15.023,27]heptacosa-2(18),5,7,9,19(27),20,22-heptaene-6,16,24-triol |
| SMILES | C=CCN1C2C[C@]34c5c(C)ccc(O)c5O[C@H]3c3c(c5cc(F)cc6c5n3CC[C@@H]6O)C[C@@]4(O)[C@@H]21 |
| InChI | InChI=1S/C28H27FN2O4/c1-3-7-30-18-12-27-21-13(2)4-5-20(33)24(21)35-26(27)23-17(11-28(27,34)25(18)30)15-9-14(29)10-16-19(32)6-8-31(23)22(15)16/h3-5,9-10,18-19,25-26,32-34H,1,6-8,11-12H2,2H3/t18?,19-,25+,26-,27-,28+,30?/m0/s1 |
| InChIKey | NOMZMQYELSHZMR-BDMADUOXSA-N |
| XLogP | 3.53 |
| TPSA | 77.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.53 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|