C27H30N2O5 — CID 89302605
2-[(1S,5R,6S,9S,10R)-6,13-dihydroxy-16-methyl-4-prop-2-enyl-11-oxa-4-azapentacyclo[8.7.0.01,6.02,5.012,17]heptadeca-12,14,16-trien-9-yl]-4,5,6,7-tetrahydroisoindole-1,3-dione (PubChem CID 89302605) has the molecular formula C27H30N2O5 and a molecular weight of 462.55 g/mol. Its IUPAC name is 2-[(1S,5R,6S,9S,10R)-6,13-dihydroxy-16-methyl-4-prop-2-enyl-11-oxa-4-azapentacyclo[8.7.0.01,6.02,5.012,17]heptadeca-12,14,16-trien-9-yl]-4,5,6,7-tetrahydroisoindole-1,3-dione.
| Compound Name | 2-[(1S,5R,6S,9S,10R)-6,13-dihydroxy-16-methyl-4-prop-2-enyl-11-oxa-4-azapentacyclo[8.7.0.01,6.02,5.012,17]heptadeca-12,14,16-trien-9-yl]-4,5,6,7-tetrahydroisoindole-1,3-dione |
|---|---|
| PubChem CID | 89302605 |
| Molecular Formula | C27H30N2O5 |
| Molecular Weight | 462.55 g/mol |
| Exact Mass | 462.22 |
| IUPAC Name | 2-[(1S,5R,6S,9S,10R)-6,13-dihydroxy-16-methyl-4-prop-2-enyl-11-oxa-4-azapentacyclo[8.7.0.01,6.02,5.012,17]heptadeca-12,14,16-trien-9-yl]-4,5,6,7-tetrahydroisoindole-1,3-dione |
| SMILES | C=CCN1CC2[C@@H]1[C@]1(O)CC[C@H](N3C(=O)C4=C(CCCC4)C3=O)[C@@H]3Oc4c(O)ccc(C)c4[C@@]231 |
| InChI | InChI=1S/C27H30N2O5/c1-3-12-28-13-17-22(28)26(33)11-10-18(29-24(31)15-6-4-5-7-16(15)25(29)32)23-27(17,26)20-14(2)8-9-19(30)21(20)34-23/h3,8-9,17-18,22-23,30,33H,1,4-7,10-13H2,2H3/t17?,18-,22+,23-,26+,27-/m0/s1 |
| InChIKey | GGBQOINWPYGOOV-NUSSFYRTSA-N |
| XLogP | 2.33 |
| TPSA | 90.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.55 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|